C34H62N6O8 — CID 139212566
2-[2-[2-[2-(4-hept-6-enyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 139212566) has the molecular formula C34H62N6O8 and a molecular weight of 682.90 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-hept-6-enyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-(4-hept-6-enyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 139212566 |
| Molecular Formula | C34H62N6O8 |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.46 |
| IUPAC Name | 2-[2-[2-[2-(4-hept-6-enyltriazol-1-yl)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | C=CCCCCCc1cn(CCOCCOCCOCCO)nn1.C=CCCCCCc1cn(CCOCCOCCOCCO)nn1 |
| InChI | InChI=1S/2C17H31N3O4/c2*1-2-3-4-5-6-7-17-16-20(19-18-17)8-10-22-12-14-24-15-13-23-11-9-21/h2*2,16,21H,1,3-15H2 |
| InChIKey | RMSOYRHXBRCQRF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 157.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|