C10H17N3O3 — CID 102409372
2-[2-[2-(4-ethenyltriazol-1-yl)ethoxy]ethoxy]ethanol (PubChem CID 102409372) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[2-[2-(4-ethenyltriazol-1-yl)ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(4-ethenyltriazol-1-yl)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 102409372 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[2-[2-(4-ethenyltriazol-1-yl)ethoxy]ethoxy]ethanol |
| SMILES | C=Cc1cn(CCOCCOCCO)nn1 |
| InChI | InChI=1S/C10H17N3O3/c1-2-10-9-13(12-11-10)3-5-15-7-8-16-6-4-14/h2,9,14H,1,3-8H2 |
| InChIKey | IGUMZUPEUYEUAH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|