C28H44N8O9 — CID 177155038
N-ethyl-2,6-bis[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]pyridine-4-carboxamide (PubChem CID 177155038) has the molecular formula C28H44N8O9 and a molecular weight of 636.71 g/mol. Its IUPAC name is N-ethyl-2,6-bis[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]pyridine-4-carboxamide.
| Compound Name | N-ethyl-2,6-bis[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 177155038 |
| Molecular Formula | C28H44N8O9 |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | N-ethyl-2,6-bis[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]pyridine-4-carboxamide |
| SMILES | CCNC(=O)c1cc(-c2cn(CCOCCOCCOCCO)nn2)nc(-c2cn(CCOCCOCCOCCO)nn2)c1 |
| InChI | InChI=1S/C28H44N8O9/c1-2-29-28(39)23-19-24(26-21-35(33-31-26)3-7-40-11-15-44-17-13-42-9-5-37)30-25(20-23)27-22-36(34-32-27)4-8-41-12-16-45-18-14-43-10-6-38/h19-22,37-38H,2-18H2,1H3,(H,29,39) |
| InChIKey | XEKYTJMBUHEIAT-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 199.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|