C16H17ClF3NO3 — CID 139214239
3-[3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarbonyl]-1-prop-2-enylpyrrolidine-2,4-dione (PubChem CID 139214239) has the molecular formula C16H17ClF3NO3 and a molecular weight of 363.76 g/mol. Its IUPAC name is 3-[3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarbonyl]-1-prop-2-enylpyrrolidine-2,4-dione.
| Compound Name | 3-[3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarbonyl]-1-prop-2-enylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 139214239 |
| Molecular Formula | C16H17ClF3NO3 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-[3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarbonyl]-1-prop-2-enylpyrrolidine-2,4-dione |
| SMILES | C=CCN1CC(=O)C(C(=O)C2C(/C=C(\Cl)C(F)(F)F)C2(C)C)C1=O |
| InChI | InChI=1S/C16H17ClF3NO3/c1-4-5-21-7-9(22)11(14(21)24)13(23)12-8(15(12,2)3)6-10(17)16(18,19)20/h4,6,8,11-12H,1,5,7H2,2-3H3/b10-6- |
| InChIKey | JPNKPLYUHRKJMJ-POHAHGRESA-N |
| XLogP | 2.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|