C17H25NO3 — CID 139214242
3-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione (PubChem CID 139214242) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione.
| Compound Name | 3-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 139214242 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione |
| SMILES | CC(C)=CC1C(C(=O)C2C(=O)CN(C(C)C)C2=O)C1(C)C |
| InChI | InChI=1S/C17H25NO3/c1-9(2)7-11-14(17(11,5)6)15(20)13-12(19)8-18(10(3)4)16(13)21/h7,10-11,13-14H,8H2,1-6H3 |
| InChIKey | WKGOHWLBCVCKIB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|