C15H19Br2NO3 — CID 71654325
3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione (PubChem CID 71654325) has the molecular formula C15H19Br2NO3 and a molecular weight of 421.13 g/mol. Its IUPAC name is 3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione.
| Compound Name | 3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 71654325 |
| Molecular Formula | C15H19Br2NO3 |
| Molecular Weight | 421.13 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]-1-propan-2-ylpyrrolidine-2,4-dione |
| SMILES | CC(C)N1CC(=O)C(C(=O)C2C(C=C(Br)Br)C2(C)C)C1=O |
| InChI | InChI=1S/C15H19Br2NO3/c1-7(2)18-6-9(19)11(14(18)21)13(20)12-8(5-10(16)17)15(12,3)4/h5,7-8,11-12H,6H2,1-4H3 |
| InChIKey | GHDWNCLOXIAWBU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|