C16H13N5O — CID 139214611
4,12-dimethyl-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 139214611) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 4,12-dimethyl-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4,12-dimethyl-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 139214611 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4,12-dimethyl-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | Cc1cc2c(nnc3c(-c4ccccc4)c(C)nn32)c(=O)[nH]1 |
| InChI | InChI=1S/C16H13N5O/c1-9-8-12-14(16(22)17-9)18-19-15-13(10(2)20-21(12)15)11-6-4-3-5-7-11/h3-8H,1-2H3,(H,17,22) |
| InChIKey | RANQOTZHWSGMIH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |