C17H16N8O — CID 71671238
N,N-dimethyl-N'-(4-methyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)methanimidamide (PubChem CID 71671238) has the molecular formula C17H16N8O and a molecular weight of 348.37 g/mol. Its IUPAC name is N,N-dimethyl-N'-(4-methyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(4-methyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)methanimidamide |
|---|---|
| PubChem CID | 71671238 |
| Molecular Formula | C17H16N8O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N,N-dimethyl-N'-(4-methyl-10-oxo-5-phenyl-2,3,7,8,11,13-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)methanimidamide |
| SMILES | Cc1nn2c(nnc3c(=O)n(/N=C/N(C)C)cnc32)c1-c1ccccc1 |
| InChI | InChI=1S/C17H16N8O/c1-11-13(12-7-5-4-6-8-12)15-21-20-14-16(25(15)22-11)18-9-24(17(14)26)19-10-23(2)3/h4-10H,1-3H3/b19-10+ |
| InChIKey | RGAGYMCUDMKIJT-VXLYETTFSA-N |
| XLogP | 1.16 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|