C20H12F4N2O2 — CID 139215016
2,4-bis[4-(2,2-difluoroethenoxy)phenyl]pyrimidine (PubChem CID 139215016) has the molecular formula C20H12F4N2O2 and a molecular weight of 388.32 g/mol. Its IUPAC name is 2,4-bis[4-(2,2-difluoroethenoxy)phenyl]pyrimidine.
| Compound Name | 2,4-bis[4-(2,2-difluoroethenoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 139215016 |
| Molecular Formula | C20H12F4N2O2 |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2,4-bis[4-(2,2-difluoroethenoxy)phenyl]pyrimidine |
| SMILES | FC(F)=COc1ccc(-c2ccnc(-c3ccc(OC=C(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H12F4N2O2/c21-18(22)11-27-15-5-1-13(2-6-15)17-9-10-25-20(26-17)14-3-7-16(8-4-14)28-12-19(23)24/h1-12H |
| InChIKey | ZNLOKVNXMDVSEV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|