C12H19ClN2 — CID 139215017
2,4-dibutyl-5-chloropyrimidine (PubChem CID 139215017) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 2,4-dibutyl-5-chloropyrimidine.
| Compound Name | 2,4-dibutyl-5-chloropyrimidine |
|---|---|
| PubChem CID | 139215017 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,4-dibutyl-5-chloropyrimidine |
| SMILES | CCCCc1ncc(Cl)c(CCCC)n1 |
| InChI | InChI=1S/C12H19ClN2/c1-3-5-7-11-10(13)9-14-12(15-11)8-6-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | YNEYYMXQXIZYHG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |