C20H16ClNO4 — CID 139215502
1-(4-chloro-2-hydroxy-5-methylphenyl)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione (PubChem CID 139215502) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-5-methylphenyl)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(4-chloro-2-hydroxy-5-methylphenyl)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 139215502 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-5-methylphenyl)-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione |
| SMILES | Cc1cc(C(=O)CC(=O)c2c(-c3ccccc3)noc2C)c(O)cc1Cl |
| InChI | InChI=1S/C20H16ClNO4/c1-11-8-14(16(23)9-15(11)21)17(24)10-18(25)19-12(2)26-22-20(19)13-6-4-3-5-7-13/h3-9,23H,10H2,1-2H3 |
| InChIKey | FOCGKYOVYYFNIV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|