C26H21NO4 — CID 139215490
1-[2-(2-hydroxyphenyl)-5-methylphenyl]-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione (PubChem CID 139215490) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-[2-(2-hydroxyphenyl)-5-methylphenyl]-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione.
| Compound Name | 1-[2-(2-hydroxyphenyl)-5-methylphenyl]-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 139215490 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[2-(2-hydroxyphenyl)-5-methylphenyl]-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propane-1,3-dione |
| SMILES | Cc1ccc(-c2ccccc2O)c(C(=O)CC(=O)c2c(-c3ccccc3)noc2C)c1 |
| InChI | InChI=1S/C26H21NO4/c1-16-12-13-19(20-10-6-7-11-22(20)28)21(14-16)23(29)15-24(30)25-17(2)31-27-26(25)18-8-4-3-5-9-18/h3-14,28H,15H2,1-2H3 |
| InChIKey | LEXYUGOLSLDIGY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|