C20H15NO4 — CID 139215507
6-methoxy-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one (PubChem CID 139215507) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 6-methoxy-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one.
| Compound Name | 6-methoxy-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 139215507 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 6-methoxy-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)chromen-4-one |
| SMILES | COc1ccc2oc(-c3c(-c4ccccc4)noc3C)cc(=O)c2c1 |
| InChI | InChI=1S/C20H15NO4/c1-12-19(20(21-25-12)13-6-4-3-5-7-13)18-11-16(22)15-10-14(23-2)8-9-17(15)24-18/h3-11H,1-2H3 |
| InChIKey | BRKQMPIEWUDTCC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |