C18H11NOS — CID 139215524
3-naphthalen-2-yl-1,4-benzothiazin-2-one (PubChem CID 139215524) has the molecular formula C18H11NOS and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-naphthalen-2-yl-1,4-benzothiazin-2-one.
| Compound Name | 3-naphthalen-2-yl-1,4-benzothiazin-2-one |
|---|---|
| PubChem CID | 139215524 |
| Molecular Formula | C18H11NOS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-naphthalen-2-yl-1,4-benzothiazin-2-one |
| SMILES | O=c1sc2ccccc2nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H11NOS/c20-18-17(19-15-7-3-4-8-16(15)21-18)14-10-9-12-5-1-2-6-13(12)11-14/h1-11H |
| InChIKey | HFNWSJARSFVOCE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |