C17H16NO5P — CID 139216427
(1-ethyl-2-oxo-3-phenylquinolin-4-yl) dihydrogen phosphate (PubChem CID 139216427) has the molecular formula C17H16NO5P and a molecular weight of 345.29 g/mol. Its IUPAC name is (1-ethyl-2-oxo-3-phenylquinolin-4-yl) dihydrogen phosphate.
| Compound Name | (1-ethyl-2-oxo-3-phenylquinolin-4-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 139216427 |
| Molecular Formula | C17H16NO5P |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (1-ethyl-2-oxo-3-phenylquinolin-4-yl) dihydrogen phosphate |
| SMILES | CCn1c(=O)c(-c2ccccc2)c(OP(=O)(O)O)c2ccccc21 |
| InChI | InChI=1S/C17H16NO5P/c1-2-18-14-11-7-6-10-13(14)16(23-24(20,21)22)15(17(18)19)12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H2,20,21,22) |
| InChIKey | PCGFMJWVYNCRKY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|