C30H24N2O — CID 102336522
1-(9-ethyl-1,2-diphenylpyrrolo[3,2-b]carbazol-3-yl)ethanone (PubChem CID 102336522) has the molecular formula C30H24N2O and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-(9-ethyl-1,2-diphenylpyrrolo[3,2-b]carbazol-3-yl)ethanone.
| Compound Name | 1-(9-ethyl-1,2-diphenylpyrrolo[3,2-b]carbazol-3-yl)ethanone |
|---|---|
| PubChem CID | 102336522 |
| Molecular Formula | C30H24N2O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-(9-ethyl-1,2-diphenylpyrrolo[3,2-b]carbazol-3-yl)ethanone |
| SMILES | CCn1c2ccccc2c2cc3c(cc21)c(-c1ccccc1)c(-c1ccccc1)n3C(C)=O |
| InChI | InChI=1S/C30H24N2O/c1-3-31-26-17-11-10-16-23(26)24-18-28-25(19-27(24)31)29(21-12-6-4-7-13-21)30(32(28)20(2)33)22-14-8-5-9-15-22/h4-19H,3H2,1-2H3 |
| InChIKey | LLTFIZKCAUVHCM-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |