C29H30N2O5 — CID 139216630
dibutyl 2-cyano-2-phenyl-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate (PubChem CID 139216630) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is dibutyl 2-cyano-2-phenyl-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate.
| Compound Name | dibutyl 2-cyano-2-phenyl-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate |
|---|---|
| PubChem CID | 139216630 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | dibutyl 2-cyano-2-phenyl-11bH-[1,3]oxazino[2,3-a]isoquinoline-3,4-dicarboxylate |
| SMILES | CCCCOC(=O)C1=C(C(=O)OCCCC)C(C#N)(c2ccccc2)OC2c3ccccc3C=CN12 |
| InChI | InChI=1S/C29H30N2O5/c1-3-5-18-34-27(32)24-25(28(33)35-19-6-4-2)31-17-16-21-12-10-11-15-23(21)26(31)36-29(24,20-30)22-13-8-7-9-14-22/h7-17,26H,3-6,18-19H2,1-2H3 |
| InChIKey | PXEFWMDRHKEGAW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|