C20H21N — CID 139217570
1-[(3S)-3-phenyl-3H-inden-1-yl]piperidine (PubChem CID 139217570) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-[(3S)-3-phenyl-3H-inden-1-yl]piperidine.
| Compound Name | 1-[(3S)-3-phenyl-3H-inden-1-yl]piperidine |
|---|---|
| PubChem CID | 139217570 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-[(3S)-3-phenyl-3H-inden-1-yl]piperidine |
| SMILES | C1=C(N2CCCCC2)c2ccccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H21N/c1-3-9-16(10-4-1)19-15-20(21-13-7-2-8-14-21)18-12-6-5-11-17(18)19/h1,3-6,9-12,15,19H,2,7-8,13-14H2/t19-/m0/s1 |
| InChIKey | DLVBWGGLFAOMMK-IBGZPJMESA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |