C14H18N2 — CID 13320887
2-phenyl-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepine (PubChem CID 13320887) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-phenyl-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepine.
| Compound Name | 2-phenyl-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepine |
|---|---|
| PubChem CID | 13320887 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-phenyl-3,5,6,7,8,9-hexahydro-2H-imidazo[1,2-a]azepine |
| SMILES | c1ccc(C2CN3CCCCCC3=N2)cc1 |
| InChI | InChI=1S/C14H18N2/c1-3-7-12(8-4-1)13-11-16-10-6-2-5-9-14(16)15-13/h1,3-4,7-8,13H,2,5-6,9-11H2 |
| InChIKey | WBXNCVNMXBMEMQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |