C28H21FN2 — CID 139218778
2-(4-fluorophenyl)-1-(4-methylphenyl)-4,5-diphenylimidazole (PubChem CID 139218778) has the molecular formula C28H21FN2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(4-methylphenyl)-4,5-diphenylimidazole.
| Compound Name | 2-(4-fluorophenyl)-1-(4-methylphenyl)-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 139218778 |
| Molecular Formula | C28H21FN2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(4-methylphenyl)-4,5-diphenylimidazole |
| SMILES | Cc1ccc(-n2c(-c3ccc(F)cc3)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21FN2/c1-20-12-18-25(19-13-20)31-27(22-10-6-3-7-11-22)26(21-8-4-2-5-9-21)30-28(31)23-14-16-24(29)17-15-23/h2-19H,1H3 |
| InChIKey | QTQZZCZAVHCYJO-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |