C22H21NO4 — CID 139218982
methyl 6-(benzylamino)-2-oxo-7,8,9,10-tetrahydrobenzo[h]chromene-4-carboxylate (PubChem CID 139218982) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl 6-(benzylamino)-2-oxo-7,8,9,10-tetrahydrobenzo[h]chromene-4-carboxylate.
| Compound Name | methyl 6-(benzylamino)-2-oxo-7,8,9,10-tetrahydrobenzo[h]chromene-4-carboxylate |
|---|---|
| PubChem CID | 139218982 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl 6-(benzylamino)-2-oxo-7,8,9,10-tetrahydrobenzo[h]chromene-4-carboxylate |
| SMILES | COC(=O)c1cc(=O)oc2c3c(c(NCc4ccccc4)cc12)CCCC3 |
| InChI | InChI=1S/C22H21NO4/c1-26-22(25)18-12-20(24)27-21-16-10-6-5-9-15(16)19(11-17(18)21)23-13-14-7-3-2-4-8-14/h2-4,7-8,11-12,23H,5-6,9-10,13H2,1H3 |
| InChIKey | MTKQCIKASQBZJQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|