C26H22BrFeN3O — CID 139220278
[1-[(4-bromophenyl)methyl]triazol-4-yl]-cyclopenta-1,3-dien-1-yl-phenylmethanol;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139220278) has the molecular formula C26H22BrFeN3O and a molecular weight of 528.23 g/mol. Its IUPAC name is [1-[(4-bromophenyl)methyl]triazol-4-yl]-cyclopenta-1,3-dien-1-yl-phenylmethanol;cyclopenta-1,3-diene;iron(2+).
| Compound Name | [1-[(4-bromophenyl)methyl]triazol-4-yl]-cyclopenta-1,3-dien-1-yl-phenylmethanol;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139220278 |
| Molecular Formula | C26H22BrFeN3O |
| Molecular Weight | 528.23 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | [1-[(4-bromophenyl)methyl]triazol-4-yl]-cyclopenta-1,3-dien-1-yl-phenylmethanol;cyclopenta-1,3-diene;iron(2+) |
| SMILES | OC(c1ccccc1)(c1ccc[cH-]1)c1cn(Cc2ccc(Br)cc2)nn1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C21H17BrN3O.C5H5.Fe/c22-19-12-10-16(11-13-19)14-25-15-20(23-24-25)21(26,18-8-4-5-9-18)17-6-2-1-3-7-17;1-2-4-5-3-1;/h1-13,15,26H,14H2;1-5H;/q2*-1;+2 |
| InChIKey | UXVQBEWKIXJEET-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.23 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|