C29H27N10O2P — CID 70803232
tris(1-benzyltriazol-4-yl)methyl N-phosphanylcarbamate (PubChem CID 70803232) has the molecular formula C29H27N10O2P and a molecular weight of 578.58 g/mol. Its IUPAC name is tris(1-benzyltriazol-4-yl)methyl N-phosphanylcarbamate.
| Compound Name | tris(1-benzyltriazol-4-yl)methyl N-phosphanylcarbamate |
|---|---|
| PubChem CID | 70803232 |
| Molecular Formula | C29H27N10O2P |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | tris(1-benzyltriazol-4-yl)methyl N-phosphanylcarbamate |
| SMILES | O=C(NP)OC(c1cn(Cc2ccccc2)nn1)(c1cn(Cc2ccccc2)nn1)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C29H27N10O2P/c40-28(33-42)41-29(25-19-37(34-30-25)16-22-10-4-1-5-11-22,26-20-38(35-31-26)17-23-12-6-2-7-13-23)27-21-39(36-32-27)18-24-14-8-3-9-15-24/h1-15,19-21H,16-18,42H2,(H,33,40) |
| InChIKey | HGQJAWVBRPWKBJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|