C29H30N9OP — CID 70803233
[(3-benzyl-1,2-dihydrotriazol-5-yl)-bis(1-benzyltriazol-4-yl)methoxy]methylphosphane (PubChem CID 70803233) has the molecular formula C29H30N9OP and a molecular weight of 551.60 g/mol. Its IUPAC name is [(3-benzyl-1,2-dihydrotriazol-5-yl)-bis(1-benzyltriazol-4-yl)methoxy]methylphosphane.
| Compound Name | [(3-benzyl-1,2-dihydrotriazol-5-yl)-bis(1-benzyltriazol-4-yl)methoxy]methylphosphane |
|---|---|
| PubChem CID | 70803233 |
| Molecular Formula | C29H30N9OP |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | [(3-benzyl-1,2-dihydrotriazol-5-yl)-bis(1-benzyltriazol-4-yl)methoxy]methylphosphane |
| SMILES | PCOC(C1=CN(Cc2ccccc2)NN1)(c1cn(Cc2ccccc2)nn1)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C29H30N9OP/c40-22-39-29(26-19-36(33-30-26)16-23-10-4-1-5-11-23,27-20-37(34-31-27)17-24-12-6-2-7-13-24)28-21-38(35-32-28)18-25-14-8-3-9-15-25/h1-15,19-21,30,33H,16-18,22,40H2 |
| InChIKey | BJGRETOTDXEQII-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|