C30H20N2O — CID 139220493
2-[3-[2-(4-methylphenyl)ethynyl]-2-phenyl-1-benzofuran-5-yl]-1H-benzimidazole (PubChem CID 139220493) has the molecular formula C30H20N2O and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-[3-[2-(4-methylphenyl)ethynyl]-2-phenyl-1-benzofuran-5-yl]-1H-benzimidazole.
| Compound Name | 2-[3-[2-(4-methylphenyl)ethynyl]-2-phenyl-1-benzofuran-5-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 139220493 |
| Molecular Formula | C30H20N2O |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[3-[2-(4-methylphenyl)ethynyl]-2-phenyl-1-benzofuran-5-yl]-1H-benzimidazole |
| SMILES | Cc1ccc(C#Cc2c(-c3ccccc3)oc3ccc(-c4nc5ccccc5[nH]4)cc23)cc1 |
| InChI | InChI=1S/C30H20N2O/c1-20-11-13-21(14-12-20)15-17-24-25-19-23(30-31-26-9-5-6-10-27(26)32-30)16-18-28(25)33-29(24)22-7-3-2-4-8-22/h2-14,16,18-19H,1H3,(H,31,32) |
| InChIKey | FICDNISDVMAPCT-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|