C20H10Cl2N2O — CID 139222012
4-chloro-14-(4-chlorophenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one (PubChem CID 139222012) has the molecular formula C20H10Cl2N2O and a molecular weight of 365.22 g/mol. Its IUPAC name is 4-chloro-14-(4-chlorophenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one.
| Compound Name | 4-chloro-14-(4-chlorophenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one |
|---|---|
| PubChem CID | 139222012 |
| Molecular Formula | C20H10Cl2N2O |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 4-chloro-14-(4-chlorophenyl)-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one |
| SMILES | O=C1c2c3cc(Cl)ccc3nc3cccc(c23)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H10Cl2N2O/c21-11-4-7-13(8-5-11)24-17-3-1-2-16-19(17)18(20(24)25)14-10-12(22)6-9-15(14)23-16/h1-10H |
| InChIKey | MOCXPTXVRYZGKC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|