About 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile
4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 139222341) has the molecular formula C25H16N4O2
and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile.
Molecular Properties
| Compound Name | 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| PubChem CID | 139222341 |
| Molecular Formula | C25H16N4O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | N#Cc1cn(-c2ccccc2)c2c(=O)n(-c3ccccc3)c(Oc3ccccc3)nc12 |
| InChI | InChI=1S/C25H16N4O2/c26-16-18-17-28(19-10-4-1-5-11-19)23-22(18)27-25(31-21-14-8-3-9-15-21)29(24(23)30)20-12-6-2-7-13-20/h1-15,17H |
| InChIKey | KUOINTHLBAZPSF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The IUPAC name of 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile (CID 139222341) is 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile.
What is the SMILES notation for 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The canonical SMILES for 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile is N#Cc1cn(-c2ccccc2)c2c(=O)n(-c3ccccc3)c(Oc3ccccc3)nc12.
What is the InChIKey of 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The InChIKey is KUOINTHLBAZPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16N4O2/c26-16-18-17-28(19-10-4-1-5-11-19)23-22(18)27-25(31-21-14-8-3-9-15-21)29(24(23)30)20-12-6-2-7-13-20/h1-15,17H.
What are the key properties of 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile has a molecular weight of 404.43 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2-phenoxy-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile is sourced from PubChem (CID 139222341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).