C53H44N4O2 — CID 139225226
3-[[5-[[3-[bis(1H-indol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1H-indol-3-yl)methyl]-1H-indole (PubChem CID 139225226) has the molecular formula C53H44N4O2 and a molecular weight of 768.96 g/mol. Its IUPAC name is 3-[[5-[[3-[bis(1H-indol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1H-indol-3-yl)methyl]-1H-indole.
| Compound Name | 3-[[5-[[3-[bis(1H-indol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1H-indol-3-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 139225226 |
| Molecular Formula | C53H44N4O2 |
| Molecular Weight | 768.96 g/mol |
| Exact Mass | 768.35 |
| IUPAC Name | 3-[[5-[[3-[bis(1H-indol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1H-indol-3-yl)methyl]-1H-indole |
| SMILES | C=CCOc1ccc(Cc2ccc(OCC=C)c(C(c3c[nH]c4ccccc34)c3c[nH]c4ccccc34)c2)cc1C(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C53H44N4O2/c1-3-25-58-50-23-21-34(28-40(50)52(42-30-54-46-17-9-5-13-36(42)46)43-31-55-47-18-10-6-14-37(43)47)27-35-22-24-51(59-26-4-2)41(29-35)53(44-32-56-48-19-11-7-15-38(44)48)45-33-57-49-20-12-8-16-39(45)49/h3-24,28-33,52-57H,1-2,25-27H2 |
| InChIKey | AWRKEAJSGVPOAS-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.96 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|