C57H52N4O2 — CID 139225230
3-[[5-[[3-[bis(1-methylindol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1-methylindol-3-yl)methyl]-1-methylindole (PubChem CID 139225230) has the molecular formula C57H52N4O2 and a molecular weight of 825.07 g/mol. Its IUPAC name is 3-[[5-[[3-[bis(1-methylindol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1-methylindol-3-yl)methyl]-1-methylindole.
| Compound Name | 3-[[5-[[3-[bis(1-methylindol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1-methylindol-3-yl)methyl]-1-methylindole |
|---|---|
| PubChem CID | 139225230 |
| Molecular Formula | C57H52N4O2 |
| Molecular Weight | 825.07 g/mol |
| Exact Mass | 824.41 |
| IUPAC Name | 3-[[5-[[3-[bis(1-methylindol-3-yl)methyl]-4-prop-2-enoxyphenyl]methyl]-2-prop-2-enoxyphenyl]-(1-methylindol-3-yl)methyl]-1-methylindole |
| SMILES | C=CCOc1ccc(Cc2ccc(OCC=C)c(C(c3cn(C)c4ccccc34)c3cn(C)c4ccccc34)c2)cc1C(c1cn(C)c2ccccc12)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C57H52N4O2/c1-7-29-62-54-27-25-38(32-44(54)56(46-34-58(3)50-21-13-9-17-40(46)50)47-35-59(4)51-22-14-10-18-41(47)51)31-39-26-28-55(63-30-8-2)45(33-39)57(48-36-60(5)52-23-15-11-19-42(48)52)49-37-61(6)53-24-16-12-20-43(49)53/h7-28,32-37,56-57H,1-2,29-31H2,3-6H3 |
| InChIKey | XEOCUJNIIYCMJZ-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 38.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.07 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|