C28H34N4O — CID 44585338
3-[4-[5-[1-[2-(dimethylamino)ethyl]indol-2-yl]-3-pyridinyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 44585338) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is 3-[4-[5-[1-[2-(dimethylamino)ethyl]indol-2-yl]-3-pyridinyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[5-[1-[2-(dimethylamino)ethyl]indol-2-yl]-3-pyridinyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 44585338 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 3-[4-[5-[1-[2-(dimethylamino)ethyl]indol-2-yl]-3-pyridinyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2cncc(-c3cc4ccccc4n3CCN(C)C)c2)cc1 |
| InChI | InChI=1S/C28H34N4O/c1-30(2)14-7-17-33-26-12-10-22(11-13-26)24-18-25(21-29-20-24)28-19-23-8-5-6-9-27(23)32(28)16-15-31(3)4/h5-6,8-13,18-21H,7,14-17H2,1-4H3 |
| InChIKey | PDSAXPZYQIRLDK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|