C25H31N3O2 — CID 90677072
(E)-3-[4-[3-(dimethylamino)propoxy]phenyl]-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide (PubChem CID 90677072) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (E)-3-[4-[3-(dimethylamino)propoxy]phenyl]-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[3-(dimethylamino)propoxy]phenyl]-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 90677072 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (E)-3-[4-[3-(dimethylamino)propoxy]phenyl]-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cc2ccccc2n1CCNC(=O)/C=C/c1ccc(OCCCN(C)C)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-20-19-22-7-4-5-8-24(22)28(20)17-15-26-25(29)14-11-21-9-12-23(13-10-21)30-18-6-16-27(2)3/h4-5,7-14,19H,6,15-18H2,1-3H3,(H,26,29)/b14-11+ |
| InChIKey | WNRIBLHYTOPIKK-SDNWHVSQSA-N |
| XLogP | 4.11 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|