C22H23BrN2O3 — CID 71499383
(E)-3-(5-bromo-2,4-dimethoxyphenyl)-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide (PubChem CID 71499383) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is (E)-3-(5-bromo-2,4-dimethoxyphenyl)-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2,4-dimethoxyphenyl)-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 71499383 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (E)-3-(5-bromo-2,4-dimethoxyphenyl)-N-[2-(2-methylindol-1-yl)ethyl]prop-2-enamide |
| SMILES | COc1cc(OC)c(/C=C/C(=O)NCCn2c(C)cc3ccccc32)cc1Br |
| InChI | InChI=1S/C22H23BrN2O3/c1-15-12-16-6-4-5-7-19(16)25(15)11-10-24-22(26)9-8-17-13-18(23)21(28-3)14-20(17)27-2/h4-9,12-14H,10-11H2,1-3H3,(H,24,26)/b9-8+ |
| InChIKey | HPFWSZOBXZFCEJ-CMDGGOBGSA-N |
| XLogP | 4.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|