C21H20ClFN2O2 — CID 71499382
(E)-3-(4-chloro-3-methoxyphenyl)-N-[2-(5-fluoro-2-methylindol-1-yl)ethyl]prop-2-enamide (PubChem CID 71499382) has the molecular formula C21H20ClFN2O2 and a molecular weight of 386.85 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-methoxyphenyl)-N-[2-(5-fluoro-2-methylindol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-3-methoxyphenyl)-N-[2-(5-fluoro-2-methylindol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 71499382 |
| Molecular Formula | C21H20ClFN2O2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (E)-3-(4-chloro-3-methoxyphenyl)-N-[2-(5-fluoro-2-methylindol-1-yl)ethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCn2c(C)cc3cc(F)ccc32)ccc1Cl |
| InChI | InChI=1S/C21H20ClFN2O2/c1-14-11-16-13-17(23)5-7-19(16)25(14)10-9-24-21(26)8-4-15-3-6-18(22)20(12-15)27-2/h3-8,11-13H,9-10H2,1-2H3,(H,24,26)/b8-4+ |
| InChIKey | RPJODYUCHVFVRU-XBXARRHUSA-N |
| XLogP | 4.58 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|