C25H25ClN2O2 — CID 70314029
6-[3-(dimethylamino)propoxy]-3-phenyl-2-pyridin-3-ylinden-1-one;hydrochloride (PubChem CID 70314029) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propoxy]-3-phenyl-2-pyridin-3-ylinden-1-one;hydrochloride.
| Compound Name | 6-[3-(dimethylamino)propoxy]-3-phenyl-2-pyridin-3-ylinden-1-one;hydrochloride |
|---|---|
| PubChem CID | 70314029 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 6-[3-(dimethylamino)propoxy]-3-phenyl-2-pyridin-3-ylinden-1-one;hydrochloride |
| SMILES | CN(C)CCCOc1ccc2c(c1)C(=O)C(c1cccnc1)=C2c1ccccc1.Cl |
| InChI | InChI=1S/C25H24N2O2.ClH/c1-27(2)14-7-15-29-20-11-12-21-22(16-20)25(28)24(19-10-6-13-26-17-19)23(21)18-8-4-3-5-9-18;/h3-6,8-13,16-17H,7,14-15H2,1-2H3;1H |
| InChIKey | OGFQWGXXROLORC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|