C13H14FN3OS — CID 139225332
4-[5-(4-fluorophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine (PubChem CID 139225332) has the molecular formula C13H14FN3OS and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine.
| Compound Name | 4-[5-(4-fluorophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine |
|---|---|
| PubChem CID | 139225332 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-6H-1,3,4-thiadiazin-2-yl]morpholine |
| SMILES | Fc1ccc(C2=NN=C(N3CCOCC3)SC2)cc1 |
| InChI | InChI=1S/C13H14FN3OS/c14-11-3-1-10(2-4-11)12-9-19-13(16-15-12)17-5-7-18-8-6-17/h1-4H,5-9H2 |
| InChIKey | WKSGAUNLSILDFB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |