C13H16BrN3OS — CID 56955895
4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine;hydrobromide (PubChem CID 56955895) has the molecular formula C13H16BrN3OS and a molecular weight of 342.26 g/mol. Its IUPAC name is 4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine;hydrobromide.
| Compound Name | 4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine;hydrobromide |
|---|---|
| PubChem CID | 56955895 |
| Molecular Formula | C13H16BrN3OS |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)morpholine;hydrobromide |
| SMILES | Br.c1ccc(C2=NN=C(N3CCOCC3)SC2)cc1 |
| InChI | InChI=1S/C13H15N3OS.BrH/c1-2-4-11(5-3-1)12-10-18-13(15-14-12)16-6-8-17-9-7-16;/h1-5H,6-10H2;1H |
| InChIKey | BEXCSSMLZBBBPJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |