C20H22N4S — CID 139225353
2-(4-methylpiperazin-1-yl)-5,6-diphenyl-6H-1,3,4-thiadiazine (PubChem CID 139225353) has the molecular formula C20H22N4S and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-5,6-diphenyl-6H-1,3,4-thiadiazine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-5,6-diphenyl-6H-1,3,4-thiadiazine |
|---|---|
| PubChem CID | 139225353 |
| Molecular Formula | C20H22N4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-5,6-diphenyl-6H-1,3,4-thiadiazine |
| SMILES | CN1CCN(C2=NN=C(c3ccccc3)C(c3ccccc3)S2)CC1 |
| InChI | InChI=1S/C20H22N4S/c1-23-12-14-24(15-13-23)20-22-21-18(16-8-4-2-5-9-16)19(25-20)17-10-6-3-7-11-17/h2-11,19H,12-15H2,1H3 |
| InChIKey | NJRTXYSMFJWSJB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |