C19H19N3S — CID 139225356
5,6-diphenyl-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine (PubChem CID 139225356) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is 5,6-diphenyl-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine.
| Compound Name | 5,6-diphenyl-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine |
|---|---|
| PubChem CID | 139225356 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5,6-diphenyl-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine |
| SMILES | c1ccc(C2=NN=C(N3CCCC3)SC2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3S/c1-3-9-15(10-4-1)17-18(16-11-5-2-6-12-16)23-19(21-20-17)22-13-7-8-14-22/h1-6,9-12,18H,7-8,13-14H2 |
| InChIKey | WVYIUEOURQVVEN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |