C13H14FN3S — CID 139225339
5-(4-fluorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine (PubChem CID 139225339) has the molecular formula C13H14FN3S and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine.
| Compound Name | 5-(4-fluorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine |
|---|---|
| PubChem CID | 139225339 |
| Molecular Formula | C13H14FN3S |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-(4-fluorophenyl)-2-pyrrolidin-1-yl-6H-1,3,4-thiadiazine |
| SMILES | Fc1ccc(C2=NN=C(N3CCCC3)SC2)cc1 |
| InChI | InChI=1S/C13H14FN3S/c14-11-5-3-10(4-6-11)12-9-18-13(16-15-12)17-7-1-2-8-17/h3-6H,1-2,7-9H2 |
| InChIKey | LYAZGCDTXGKGFL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |