C16H12FN3S — CID 172943376
(E)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenyl-5H-1,3-thiazol-2-imine (PubChem CID 172943376) has the molecular formula C16H12FN3S and a molecular weight of 297.36 g/mol. Its IUPAC name is (E)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenyl-5H-1,3-thiazol-2-imine.
| Compound Name | (E)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenyl-5H-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 172943376 |
| Molecular Formula | C16H12FN3S |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (E)-N-[(E)-(4-fluorophenyl)methylideneamino]-4-phenyl-5H-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/C=N/N=C2/N=C(c3ccccc3)CS2)cc1 |
| InChI | InChI=1S/C16H12FN3S/c17-14-8-6-12(7-9-14)10-18-20-16-19-15(11-21-16)13-4-2-1-3-5-13/h1-10H,11H2/b18-10+,20-16- |
| InChIKey | MUVUEGIHJHTENF-PFTNRUMESA-N |
| XLogP | 3.75 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|