C16H13FN2S — CID 134691423
4-(4-fluorophenyl)-6-phenyl-2H-1,3-thiazin-2-amine (PubChem CID 134691423) has the molecular formula C16H13FN2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-6-phenyl-2H-1,3-thiazin-2-amine.
| Compound Name | 4-(4-fluorophenyl)-6-phenyl-2H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 134691423 |
| Molecular Formula | C16H13FN2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(4-fluorophenyl)-6-phenyl-2H-1,3-thiazin-2-amine |
| SMILES | NC1N=C(c2ccc(F)cc2)C=C(c2ccccc2)S1 |
| InChI | InChI=1S/C16H13FN2S/c17-13-8-6-11(7-9-13)14-10-15(20-16(18)19-14)12-4-2-1-3-5-12/h1-10,16H,18H2 |
| InChIKey | PLIHOPHPVJIGKV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |