C11H11FN2S — CID 141296388
6-(4-fluorophenyl)-4-methyl-2H-1,3-thiazin-2-amine (PubChem CID 141296388) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-methyl-2H-1,3-thiazin-2-amine.
| Compound Name | 6-(4-fluorophenyl)-4-methyl-2H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 141296388 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6-(4-fluorophenyl)-4-methyl-2H-1,3-thiazin-2-amine |
| SMILES | CC1=NC(N)SC(c2ccc(F)cc2)=C1 |
| InChI | InChI=1S/C11H11FN2S/c1-7-6-10(15-11(13)14-7)8-2-4-9(12)5-3-8/h2-6,11H,13H2,1H3 |
| InChIKey | WZKFLKQEQCRCIA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |