C9H12F2N4S — CID 91468971
2-[amino-[(2,4-difluorophenyl)methylsulfanyl]methyl]guanidine (PubChem CID 91468971) has the molecular formula C9H12F2N4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-[amino-[(2,4-difluorophenyl)methylsulfanyl]methyl]guanidine.
| Compound Name | 2-[amino-[(2,4-difluorophenyl)methylsulfanyl]methyl]guanidine |
|---|---|
| PubChem CID | 91468971 |
| Molecular Formula | C9H12F2N4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-[amino-[(2,4-difluorophenyl)methylsulfanyl]methyl]guanidine |
| SMILES | NC(N)=NC(N)SCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H12F2N4S/c10-6-2-1-5(7(11)3-6)4-16-9(14)15-8(12)13/h1-3,9H,4,14H2,(H4,12,13,15) |
| InChIKey | FJQDHWJKEQVKDX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|