C24H21N5O3S2 — CID 139226047
ethyl 2-anilino-4-methyl-5-[(5-phenyldiazenyl-1,3-thiazol-2-yl)carbamoyl]thiophene-3-carboxylate (PubChem CID 139226047) has the molecular formula C24H21N5O3S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is ethyl 2-anilino-4-methyl-5-[(5-phenyldiazenyl-1,3-thiazol-2-yl)carbamoyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-anilino-4-methyl-5-[(5-phenyldiazenyl-1,3-thiazol-2-yl)carbamoyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 139226047 |
| Molecular Formula | C24H21N5O3S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | ethyl 2-anilino-4-methyl-5-[(5-phenyldiazenyl-1,3-thiazol-2-yl)carbamoyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccccc2)sc(C(=O)Nc2ncc(/N=N/c3ccccc3)s2)c1C |
| InChI | InChI=1S/C24H21N5O3S2/c1-3-32-23(31)19-15(2)20(34-22(19)26-16-10-6-4-7-11-16)21(30)27-24-25-14-18(33-24)29-28-17-12-8-5-9-13-17/h4-14,26H,3H2,1-2H3,(H,25,27,30)/b29-28+ |
| InChIKey | VFCGAANUDUCZNK-ZQHSETAFSA-N |
| XLogP | 7.10 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|