C24H20N6O5S2 — CID 139226049
ethyl 2-anilino-4-methyl-5-[[5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-2-yl]carbamoyl]thiophene-3-carboxylate (PubChem CID 139226049) has the molecular formula C24H20N6O5S2 and a molecular weight of 536.60 g/mol. Its IUPAC name is ethyl 2-anilino-4-methyl-5-[[5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-2-yl]carbamoyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-anilino-4-methyl-5-[[5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-2-yl]carbamoyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 139226049 |
| Molecular Formula | C24H20N6O5S2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | ethyl 2-anilino-4-methyl-5-[[5-[(4-nitrophenyl)diazenyl]-1,3-thiazol-2-yl]carbamoyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccccc2)sc(C(=O)Nc2ncc(/N=N/c3ccc([N+](=O)[O-])cc3)s2)c1C |
| InChI | InChI=1S/C24H20N6O5S2/c1-3-35-23(32)19-14(2)20(37-22(19)26-15-7-5-4-6-8-15)21(31)27-24-25-13-18(36-24)29-28-16-9-11-17(12-10-16)30(33)34/h4-13,26H,3H2,1-2H3,(H,25,27,31)/b29-28+ |
| InChIKey | JMQXZXYCZCYSPH-ZQHSETAFSA-N |
| XLogP | 7.01 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|