C29H20Cl2N2O4 — CID 139226180
3,5-bis(4-chlorophenyl)-2-phenoxy-5,7,8,9-tetrahydrochromeno[2,3-d]pyrimidine-4,6-dione (PubChem CID 139226180) has the molecular formula C29H20Cl2N2O4 and a molecular weight of 531.40 g/mol. Its IUPAC name is 3,5-bis(4-chlorophenyl)-2-phenoxy-5,7,8,9-tetrahydrochromeno[2,3-d]pyrimidine-4,6-dione.
| Compound Name | 3,5-bis(4-chlorophenyl)-2-phenoxy-5,7,8,9-tetrahydrochromeno[2,3-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 139226180 |
| Molecular Formula | C29H20Cl2N2O4 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 3,5-bis(4-chlorophenyl)-2-phenoxy-5,7,8,9-tetrahydrochromeno[2,3-d]pyrimidine-4,6-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(Cl)cc1)c1c(nc(Oc3ccccc3)n(-c3ccc(Cl)cc3)c1=O)O2 |
| InChI | InChI=1S/C29H20Cl2N2O4/c30-18-11-9-17(10-12-18)24-25-22(34)7-4-8-23(25)37-27-26(24)28(35)33(20-15-13-19(31)14-16-20)29(32-27)36-21-5-2-1-3-6-21/h1-3,5-6,9-16,24H,4,7-8H2 |
| InChIKey | BLGVDJDQTXQGBS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |