C16H22N2O2 — CID 139229192
ethyl (3S)-3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 139229192) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl (3S)-3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl (3S)-3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 139229192 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | ethyl (3S)-3-butyl-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCCC[C@H]1CC(C(=O)OCC)=NN1c1ccccc1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-5-9-14-12-15(16(19)20-4-2)17-18(14)13-10-7-6-8-11-13/h6-8,10-11,14H,3-5,9,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | SOQMOHJXRYHFCI-AWEZNQCLSA-N |
| XLogP | 3.37 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |