C16H22N2O3 — CID 139229193
ethyl (3S)-3-butoxy-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 139229193) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl (3S)-3-butoxy-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl (3S)-3-butoxy-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 139229193 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethyl (3S)-3-butoxy-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCCCO[C@H]1CC(C(=O)OCC)=NN1c1ccccc1 |
| InChI | InChI=1S/C16H22N2O3/c1-3-5-11-21-15-12-14(16(19)20-4-2)17-18(15)13-9-7-6-8-10-13/h6-10,15H,3-5,11-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | DXGPSUQRUOQIAN-HNNXBMFYSA-N |
| XLogP | 2.96 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|