C11H21N3 — CID 139230318
4,5-ditert-butyl-1H-imidazol-2-amine (PubChem CID 139230318) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 4,5-ditert-butyl-1H-imidazol-2-amine.
| Compound Name | 4,5-ditert-butyl-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 139230318 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 4,5-ditert-butyl-1H-imidazol-2-amine |
| SMILES | CC(C)(C)c1nc(N)[nH]c1C(C)(C)C |
| InChI | InChI=1S/C11H21N3/c1-10(2,3)7-8(11(4,5)6)14-9(12)13-7/h1-6H3,(H3,12,13,14) |
| InChIKey | XXMLYVMYLHSYFY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |