C26H20N6O2 — CID 139231542
4-(5-methyl-1-phenyltriazole-4-carbonyl)-N,1-diphenylpyrazole-3-carboxamide (PubChem CID 139231542) has the molecular formula C26H20N6O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 4-(5-methyl-1-phenyltriazole-4-carbonyl)-N,1-diphenylpyrazole-3-carboxamide.
| Compound Name | 4-(5-methyl-1-phenyltriazole-4-carbonyl)-N,1-diphenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 139231542 |
| Molecular Formula | C26H20N6O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-(5-methyl-1-phenyltriazole-4-carbonyl)-N,1-diphenylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)c2cn(-c3ccccc3)nc2C(=O)Nc2ccccc2)nnn1-c1ccccc1 |
| InChI | InChI=1S/C26H20N6O2/c1-18-23(28-30-32(18)21-15-9-4-10-16-21)25(33)22-17-31(20-13-7-3-8-14-20)29-24(22)26(34)27-19-11-5-2-6-12-19/h2-17H,1H3,(H,27,34) |
| InChIKey | WYLHXESTSSMJSG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |